C13H22ClN5O — CID 126965274
2-[4-[[2-(2-methylpropyl)pyrazol-3-yl]methylamino]pyrazol-1-yl]ethanol;hydrochloride (PubChem CID 126965274) has the molecular formula C13H22ClN5O and a molecular weight of 299.81 g/mol. Its IUPAC name is 2-[4-[[2-(2-methylpropyl)pyrazol-3-yl]methylamino]pyrazol-1-yl]ethanol;hydrochloride.
| Compound Name | 2-[4-[[2-(2-methylpropyl)pyrazol-3-yl]methylamino]pyrazol-1-yl]ethanol;hydrochloride |
|---|---|
| PubChem CID | 126965274 |
| Molecular Formula | C13H22ClN5O |
| Molecular Weight | 299.81 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 2-[4-[[2-(2-methylpropyl)pyrazol-3-yl]methylamino]pyrazol-1-yl]ethanol;hydrochloride |
| SMILES | CC(C)Cn1nccc1CNc1cnn(CCO)c1.Cl |
| InChI | InChI=1S/C13H21N5O.ClH/c1-11(2)9-18-13(3-4-15-18)8-14-12-7-16-17(10-12)5-6-19;/h3-4,7,10-11,14,19H,5-6,8-9H2,1-2H3;1H |
| InChIKey | XTAAAGJDFRNOIJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 67.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.81 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |