C17H32Cl2N4O — CID 126967056
N-[(3-cyclopropyl-1-propan-2-ylpyrazol-5-yl)methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride (PubChem CID 126967056) has the molecular formula C17H32Cl2N4O and a molecular weight of 379.38 g/mol. Its IUPAC name is N-[(3-cyclopropyl-1-propan-2-ylpyrazol-5-yl)methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride.
| Compound Name | N-[(3-cyclopropyl-1-propan-2-ylpyrazol-5-yl)methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 126967056 |
| Molecular Formula | C17H32Cl2N4O |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | N-[(3-cyclopropyl-1-propan-2-ylpyrazol-5-yl)methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride |
| SMILES | CC(C)n1nc(C2CC2)cc1CNCCCN1CCOCC1.Cl.Cl |
| InChI | InChI=1S/C17H30N4O.2ClH/c1-14(2)21-16(12-17(19-21)15-4-5-15)13-18-6-3-7-20-8-10-22-11-9-20;;/h12,14-15,18H,3-11,13H2,1-2H3;2*1H |
| InChIKey | WIFSYHLPQLTMDX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|