C14H28Cl2N4O — CID 126964926
N-[(2-butan-2-ylpyrazol-3-yl)methyl]-2-morpholin-4-ylethanamine;dihydrochloride (PubChem CID 126964926) has the molecular formula C14H28Cl2N4O and a molecular weight of 339.31 g/mol. Its IUPAC name is N-[(2-butan-2-ylpyrazol-3-yl)methyl]-2-morpholin-4-ylethanamine;dihydrochloride.
| Compound Name | N-[(2-butan-2-ylpyrazol-3-yl)methyl]-2-morpholin-4-ylethanamine;dihydrochloride |
|---|---|
| PubChem CID | 126964926 |
| Molecular Formula | C14H28Cl2N4O |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-[(2-butan-2-ylpyrazol-3-yl)methyl]-2-morpholin-4-ylethanamine;dihydrochloride |
| SMILES | CCC(C)n1nccc1CNCCN1CCOCC1.Cl.Cl |
| InChI | InChI=1S/C14H26N4O.2ClH/c1-3-13(2)18-14(4-5-16-18)12-15-6-7-17-8-10-19-11-9-17;;/h4-5,13,15H,3,6-12H2,1-2H3;2*1H |
| InChIKey | FSKRLVSXBSYUMS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|