C15H30Cl2N4O — CID 126965875
N-[[2-(2-methylpropyl)pyrazol-3-yl]methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride (PubChem CID 126965875) has the molecular formula C15H30Cl2N4O and a molecular weight of 353.34 g/mol. Its IUPAC name is N-[[2-(2-methylpropyl)pyrazol-3-yl]methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride.
| Compound Name | N-[[2-(2-methylpropyl)pyrazol-3-yl]methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 126965875 |
| Molecular Formula | C15H30Cl2N4O |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-[[2-(2-methylpropyl)pyrazol-3-yl]methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride |
| SMILES | CC(C)Cn1nccc1CNCCCN1CCOCC1.Cl.Cl |
| InChI | InChI=1S/C15H28N4O.2ClH/c1-14(2)13-19-15(4-6-17-19)12-16-5-3-7-18-8-10-20-11-9-18;;/h4,6,14,16H,3,5,7-13H2,1-2H3;2*1H |
| InChIKey | BHYSZSBJTHNWPN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|