C13H16ClF2N3O — CID 126967408
N-[[2-(difluoromethyl)pyrazol-3-yl]methyl]-1-(2-methoxyphenyl)methanamine;hydrochloride (PubChem CID 126967408) has the molecular formula C13H16ClF2N3O and a molecular weight of 303.74 g/mol. Its IUPAC name is N-[[2-(difluoromethyl)pyrazol-3-yl]methyl]-1-(2-methoxyphenyl)methanamine;hydrochloride.
| Compound Name | N-[[2-(difluoromethyl)pyrazol-3-yl]methyl]-1-(2-methoxyphenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 126967408 |
| Molecular Formula | C13H16ClF2N3O |
| Molecular Weight | 303.74 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | N-[[2-(difluoromethyl)pyrazol-3-yl]methyl]-1-(2-methoxyphenyl)methanamine;hydrochloride |
| SMILES | COc1ccccc1CNCc1ccnn1C(F)F.Cl |
| InChI | InChI=1S/C13H15F2N3O.ClH/c1-19-12-5-3-2-4-10(12)8-16-9-11-6-7-17-18(11)13(14)15;/h2-7,13,16H,8-9H2,1H3;1H |
| InChIKey | RZFYSYAFXMJKMC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.74 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |