C7H9F8N — CID 12696965
2,2,3,3-tetrafluoro-N-methyl-N-(2,2,3,3-tetrafluoropropyl)propan-1-amine (PubChem CID 12696965) has the molecular formula C7H9F8N and a molecular weight of 259.14 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-methyl-N-(2,2,3,3-tetrafluoropropyl)propan-1-amine.
| Compound Name | 2,2,3,3-tetrafluoro-N-methyl-N-(2,2,3,3-tetrafluoropropyl)propan-1-amine |
|---|---|
| PubChem CID | 12696965 |
| Molecular Formula | C7H9F8N |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-methyl-N-(2,2,3,3-tetrafluoropropyl)propan-1-amine |
| SMILES | CN(CC(F)(F)C(F)F)CC(F)(F)C(F)F |
| InChI | InChI=1S/C7H9F8N/c1-16(2-6(12,13)4(8)9)3-7(14,15)5(10)11/h4-5H,2-3H2,1H3 |
| InChIKey | IXGLRTBRDULAAZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|