C28H33NO — CID 126970750
(1R,15S,18S,19R)-18,19-dimethyl-15-propan-2-yl-11-azahexacyclo[13.7.2.01,18.02,14.04,12.05,10]tetracosa-2(14),3,5,7,9,12-hexaen-22-one (PubChem CID 126970750) has the molecular formula C28H33NO and a molecular weight of 399.58 g/mol. Its IUPAC name is (1R,15S,18S,19R)-18,19-dimethyl-15-propan-2-yl-11-azahexacyclo[13.7.2.01,18.02,14.04,12.05,10]tetracosa-2(14),3,5,7,9,12-hexaen-22-one.
| Compound Name | (1R,15S,18S,19R)-18,19-dimethyl-15-propan-2-yl-11-azahexacyclo[13.7.2.01,18.02,14.04,12.05,10]tetracosa-2(14),3,5,7,9,12-hexaen-22-one |
|---|---|
| PubChem CID | 126970750 |
| Molecular Formula | C28H33NO |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | (1R,15S,18S,19R)-18,19-dimethyl-15-propan-2-yl-11-azahexacyclo[13.7.2.01,18.02,14.04,12.05,10]tetracosa-2(14),3,5,7,9,12-hexaen-22-one |
| SMILES | CC(C)[C@@]12CC[C@]3(C(=O)CC[C@@H](C)[C@]3(C)CC1)c1cc3c(cc12)[nH]c1ccccc13 |
| InChI | InChI=1S/C28H33NO/c1-17(2)27-12-11-26(4)18(3)9-10-25(30)28(26,14-13-27)22-15-20-19-7-5-6-8-23(19)29-24(20)16-21(22)27/h5-8,15-18,29H,9-14H2,1-4H3/t18-,26+,27+,28-/m1/s1 |
| InChIKey | VENDDHANDFPFLV-YRVHMGLVSA-N |
| XLogP | 7.05 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |