C8H8ClN5 — CID 126974131
5-(chloromethyl)-4-methyl-2-(2H-triazol-4-yl)pyrimidine (PubChem CID 126974131) has the molecular formula C8H8ClN5 and a molecular weight of 209.64 g/mol. Its IUPAC name is 5-(chloromethyl)-4-methyl-2-(2H-triazol-4-yl)pyrimidine.
| Compound Name | 5-(chloromethyl)-4-methyl-2-(2H-triazol-4-yl)pyrimidine |
|---|---|
| PubChem CID | 126974131 |
| Molecular Formula | C8H8ClN5 |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 5-(chloromethyl)-4-methyl-2-(2H-triazol-4-yl)pyrimidine |
| SMILES | Cc1nc(-c2cn[nH]n2)ncc1CCl |
| InChI | InChI=1S/C8H8ClN5/c1-5-6(2-9)3-10-8(12-5)7-4-11-14-13-7/h3-4H,2H2,1H3,(H,11,13,14) |
| InChIKey | IFJFXHJNBOFDJU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|