C11H16ClN3 — CID 130920630
5-(chloromethyl)-2-(3,3-dimethylazetidin-1-yl)-4-methylpyrimidine (PubChem CID 130920630) has the molecular formula C11H16ClN3 and a molecular weight of 225.72 g/mol. Its IUPAC name is 5-(chloromethyl)-2-(3,3-dimethylazetidin-1-yl)-4-methylpyrimidine.
| Compound Name | 5-(chloromethyl)-2-(3,3-dimethylazetidin-1-yl)-4-methylpyrimidine |
|---|---|
| PubChem CID | 130920630 |
| Molecular Formula | C11H16ClN3 |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 5-(chloromethyl)-2-(3,3-dimethylazetidin-1-yl)-4-methylpyrimidine |
| SMILES | Cc1nc(N2CC(C)(C)C2)ncc1CCl |
| InChI | InChI=1S/C11H16ClN3/c1-8-9(4-12)5-13-10(14-8)15-6-11(2,3)7-15/h5H,4,6-7H2,1-3H3 |
| InChIKey | LYUGWPVVOFYTKR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|