C14H20ClN3 — CID 83183891
1-[5-(chloromethyl)-4-methylpyrimidin-2-yl]-2,3,3a,4,5,6,7,7a-octahydroindole (PubChem CID 83183891) has the molecular formula C14H20ClN3 and a molecular weight of 265.79 g/mol. Its IUPAC name is 1-[5-(chloromethyl)-4-methylpyrimidin-2-yl]-2,3,3a,4,5,6,7,7a-octahydroindole.
| Compound Name | 1-[5-(chloromethyl)-4-methylpyrimidin-2-yl]-2,3,3a,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 83183891 |
| Molecular Formula | C14H20ClN3 |
| Molecular Weight | 265.79 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1-[5-(chloromethyl)-4-methylpyrimidin-2-yl]-2,3,3a,4,5,6,7,7a-octahydroindole |
| SMILES | Cc1nc(N2CCC3CCCCC32)ncc1CCl |
| InChI | InChI=1S/C14H20ClN3/c1-10-12(8-15)9-16-14(17-10)18-7-6-11-4-2-3-5-13(11)18/h9,11,13H,2-8H2,1H3 |
| InChIKey | RBPUHLKRIPTJBZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.79 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|