About 2-(carbamothioylamino)-2,3-dimethylbutanamide
2-(carbamothioylamino)-2,3-dimethylbutanamide (PubChem CID 126978502) has the molecular formula C7H15N3OS
and a molecular weight of 189.28 g/mol. Its IUPAC name is 2-(carbamothioylamino)-2,3-dimethylbutanamide.
Molecular Properties
| Compound Name | 2-(carbamothioylamino)-2,3-dimethylbutanamide |
| PubChem CID | 126978502 |
| Molecular Formula | C7H15N3OS |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 2-(carbamothioylamino)-2,3-dimethylbutanamide |
| SMILES | CC(C)C(C)(NC(N)=S)C(N)=O |
| InChI | InChI=1S/C7H15N3OS/c1-4(2)7(3,5(8)11)10-6(9)12/h4H,1-3H3,(H2,8,11)(H3,9,10,12) |
| InChIKey | VCXJMASBHPVTMM-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(carbamothioylamino)-2,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(carbamothioylamino)-2,3-dimethylbutanamide?
The IUPAC name of 2-(carbamothioylamino)-2,3-dimethylbutanamide (CID 126978502) is 2-(carbamothioylamino)-2,3-dimethylbutanamide.
What is the SMILES notation for 2-(carbamothioylamino)-2,3-dimethylbutanamide?
The canonical SMILES for 2-(carbamothioylamino)-2,3-dimethylbutanamide is CC(C)C(C)(NC(N)=S)C(N)=O.
What is the InChIKey of 2-(carbamothioylamino)-2,3-dimethylbutanamide?
The InChIKey is VCXJMASBHPVTMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3OS/c1-4(2)7(3,5(8)11)10-6(9)12/h4H,1-3H3,(H2,8,11)(H3,9,10,12).
What are the key properties of 2-(carbamothioylamino)-2,3-dimethylbutanamide?
2-(carbamothioylamino)-2,3-dimethylbutanamide has a molecular weight of 189.28 g/mol, XLogP of -0.28, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(carbamothioylamino)-2,3-dimethylbutanamide is sourced from PubChem (CID 126978502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).