C11H14ClNO — CID 126978992
6-chloro-7-methoxy-4-methyl-1,2,3,4-tetrahydroquinoline (PubChem CID 126978992) has the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. Its IUPAC name is 6-chloro-7-methoxy-4-methyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-chloro-7-methoxy-4-methyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 126978992 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 6-chloro-7-methoxy-4-methyl-1,2,3,4-tetrahydroquinoline |
| SMILES | COc1cc2c(cc1Cl)C(C)CCN2 |
| InChI | InChI=1S/C11H14ClNO/c1-7-3-4-13-10-6-11(14-2)9(12)5-8(7)10/h5-7,13H,3-4H2,1-2H3 |
| InChIKey | VHMCCFWGQOQAQA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |