About 1-methylcyclopropane-1-carbonyl isothiocyanate
1-methylcyclopropane-1-carbonyl isothiocyanate (PubChem CID 126981155) has the molecular formula C6H7NOS
and a molecular weight of 141.19 g/mol. Its IUPAC name is 1-methylcyclopropane-1-carbonyl isothiocyanate.
Molecular Properties
| Compound Name | 1-methylcyclopropane-1-carbonyl isothiocyanate |
| PubChem CID | 126981155 |
| Molecular Formula | C6H7NOS |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.02 |
| IUPAC Name | 1-methylcyclopropane-1-carbonyl isothiocyanate |
| SMILES | CC1(C(=O)N=C=S)CC1 |
| InChI | InChI=1S/C6H7NOS/c1-6(2-3-6)5(8)7-4-9/h2-3H2,1H3 |
| InChIKey | VVWXXIDXSPTCBY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-methylcyclopropane-1-carbonyl isothiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylcyclopropane-1-carbonyl isothiocyanate?
The IUPAC name of 1-methylcyclopropane-1-carbonyl isothiocyanate (CID 126981155) is 1-methylcyclopropane-1-carbonyl isothiocyanate.
What is the SMILES notation for 1-methylcyclopropane-1-carbonyl isothiocyanate?
The canonical SMILES for 1-methylcyclopropane-1-carbonyl isothiocyanate is CC1(C(=O)N=C=S)CC1.
What is the InChIKey of 1-methylcyclopropane-1-carbonyl isothiocyanate?
The InChIKey is VVWXXIDXSPTCBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NOS/c1-6(2-3-6)5(8)7-4-9/h2-3H2,1H3.
What are the key properties of 1-methylcyclopropane-1-carbonyl isothiocyanate?
1-methylcyclopropane-1-carbonyl isothiocyanate has a molecular weight of 141.19 g/mol, XLogP of 1.42, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylcyclopropane-1-carbonyl isothiocyanate is sourced from PubChem (CID 126981155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).