C12H23NO — CID 126983726
(6,9-dimethyl-1-oxaspiro[4.5]decan-2-yl)methanamine (PubChem CID 126983726) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (6,9-dimethyl-1-oxaspiro[4.5]decan-2-yl)methanamine.
| Compound Name | (6,9-dimethyl-1-oxaspiro[4.5]decan-2-yl)methanamine |
|---|---|
| PubChem CID | 126983726 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (6,9-dimethyl-1-oxaspiro[4.5]decan-2-yl)methanamine |
| SMILES | CC1CCC(C)C2(CCC(CN)O2)C1 |
| InChI | InChI=1S/C12H23NO/c1-9-3-4-10(2)12(7-9)6-5-11(8-13)14-12/h9-11H,3-8,13H2,1-2H3 |
| InChIKey | LONNSNNKTXDVAP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |