C8H12N4O2 — CID 126985525
6-nitro-2-N-propan-2-ylpyridine-2,5-diamine (PubChem CID 126985525) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is 6-nitro-2-N-propan-2-ylpyridine-2,5-diamine.
| Compound Name | 6-nitro-2-N-propan-2-ylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 126985525 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 6-nitro-2-N-propan-2-ylpyridine-2,5-diamine |
| SMILES | CC(C)Nc1ccc(N)c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C8H12N4O2/c1-5(2)10-7-4-3-6(9)8(11-7)12(13)14/h3-5H,9H2,1-2H3,(H,10,11) |
| InChIKey | RCAYFOKWXRXFAD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|