C8H12N2OS — CID 126985781
oxolan-2-yl(1,2-thiazol-3-yl)methanamine (PubChem CID 126985781) has the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. Its IUPAC name is oxolan-2-yl(1,2-thiazol-3-yl)methanamine.
| Compound Name | oxolan-2-yl(1,2-thiazol-3-yl)methanamine |
|---|---|
| PubChem CID | 126985781 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | oxolan-2-yl(1,2-thiazol-3-yl)methanamine |
| SMILES | NC(c1ccsn1)C1CCCO1 |
| InChI | InChI=1S/C8H12N2OS/c9-8(6-3-5-12-10-6)7-2-1-4-11-7/h3,5,7-8H,1-2,4,9H2 |
| InChIKey | NJRJGBHNMNGJFL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |