C10H16N2OS — CID 130631850
(1-methoxycyclopentyl)-(1,2-thiazol-3-yl)methanamine (PubChem CID 130631850) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is (1-methoxycyclopentyl)-(1,2-thiazol-3-yl)methanamine.
| Compound Name | (1-methoxycyclopentyl)-(1,2-thiazol-3-yl)methanamine |
|---|---|
| PubChem CID | 130631850 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (1-methoxycyclopentyl)-(1,2-thiazol-3-yl)methanamine |
| SMILES | COC1(C(N)c2ccsn2)CCCC1 |
| InChI | InChI=1S/C10H16N2OS/c1-13-10(5-2-3-6-10)9(11)8-4-7-14-12-8/h4,7,9H,2-3,5-6,11H2,1H3 |
| InChIKey | OCBDDOLNPJVALZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |