C10H16N2OS — CID 130840669
(2-ethyloxolan-3-yl)-(1,2-thiazol-3-yl)methanamine (PubChem CID 130840669) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is (2-ethyloxolan-3-yl)-(1,2-thiazol-3-yl)methanamine.
| Compound Name | (2-ethyloxolan-3-yl)-(1,2-thiazol-3-yl)methanamine |
|---|---|
| PubChem CID | 130840669 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (2-ethyloxolan-3-yl)-(1,2-thiazol-3-yl)methanamine |
| SMILES | CCC1OCCC1C(N)c1ccsn1 |
| InChI | InChI=1S/C10H16N2OS/c1-2-9-7(3-5-13-9)10(11)8-4-6-14-12-8/h4,6-7,9-10H,2-3,5,11H2,1H3 |
| InChIKey | QLQOZQOLNCKBSQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |