C9H14N2OS — CID 127002573
4-(1,2-thiazol-3-yl)oxepan-4-amine (PubChem CID 127002573) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is 4-(1,2-thiazol-3-yl)oxepan-4-amine.
| Compound Name | 4-(1,2-thiazol-3-yl)oxepan-4-amine |
|---|---|
| PubChem CID | 127002573 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 4-(1,2-thiazol-3-yl)oxepan-4-amine |
| SMILES | NC1(c2ccsn2)CCCOCC1 |
| InChI | InChI=1S/C9H14N2OS/c10-9(8-2-7-13-11-8)3-1-5-12-6-4-9/h2,7H,1,3-6,10H2 |
| InChIKey | VATHFOPTFUHEEG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |