C8H11N3O2 — CID 126986453
N-hydroxy-4,5,6,7-tetrahydro-1H-indazole-7-carboxamide (PubChem CID 126986453) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is N-hydroxy-4,5,6,7-tetrahydro-1H-indazole-7-carboxamide.
| Compound Name | N-hydroxy-4,5,6,7-tetrahydro-1H-indazole-7-carboxamide |
|---|---|
| PubChem CID | 126986453 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | N-hydroxy-4,5,6,7-tetrahydro-1H-indazole-7-carboxamide |
| SMILES | O=C(NO)C1CCCc2cn[nH]c21 |
| InChI | InChI=1S/C8H11N3O2/c12-8(11-13)6-3-1-2-5-4-9-10-7(5)6/h4,6,13H,1-3H2,(H,9,10)(H,11,12) |
| InChIKey | MIPDTYQHNBPJOK-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|