C14H16N4O — CID 97228997
1-phenyl-3-[(7S)-4,5,6,7-tetrahydro-1H-indazol-7-yl]urea (PubChem CID 97228997) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 1-phenyl-3-[(7S)-4,5,6,7-tetrahydro-1H-indazol-7-yl]urea.
| Compound Name | 1-phenyl-3-[(7S)-4,5,6,7-tetrahydro-1H-indazol-7-yl]urea |
|---|---|
| PubChem CID | 97228997 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 1-phenyl-3-[(7S)-4,5,6,7-tetrahydro-1H-indazol-7-yl]urea |
| SMILES | O=C(Nc1ccccc1)N[C@H]1CCCc2cn[nH]c21 |
| InChI | InChI=1S/C14H16N4O/c19-14(16-11-6-2-1-3-7-11)17-12-8-4-5-10-9-15-18-13(10)12/h1-3,6-7,9,12H,4-5,8H2,(H,15,18)(H2,16,17,19)/t12-/m0/s1 |
| InChIKey | HHEPZUFELBJLQB-LBPRGKRZSA-N |
| XLogP | 2.61 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |