C15H20N6O — CID 155950298
1,3-bis(4,5,6,7-tetrahydro-1H-indazol-7-yl)urea (PubChem CID 155950298) has the molecular formula C15H20N6O and a molecular weight of 300.37 g/mol. Its IUPAC name is 1,3-bis(4,5,6,7-tetrahydro-1H-indazol-7-yl)urea.
| Compound Name | 1,3-bis(4,5,6,7-tetrahydro-1H-indazol-7-yl)urea |
|---|---|
| PubChem CID | 155950298 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 1,3-bis(4,5,6,7-tetrahydro-1H-indazol-7-yl)urea |
| SMILES | O=C(NC1CCCc2cn[nH]c21)NC1CCCc2cn[nH]c21 |
| InChI | InChI=1S/C15H20N6O/c22-15(18-11-5-1-3-9-7-16-20-13(9)11)19-12-6-2-4-10-8-17-21-14(10)12/h7-8,11-12H,1-6H2,(H,16,20)(H,17,21)(H2,18,19,22) |
| InChIKey | YWMXYMFDDRNCEH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |