C15H18N4O2 — CID 75482362
1-(3-methoxyphenyl)-3-(4,5,6,7-tetrahydro-1H-indazol-7-yl)urea (PubChem CID 75482362) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-(4,5,6,7-tetrahydro-1H-indazol-7-yl)urea.
| Compound Name | 1-(3-methoxyphenyl)-3-(4,5,6,7-tetrahydro-1H-indazol-7-yl)urea |
|---|---|
| PubChem CID | 75482362 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-(4,5,6,7-tetrahydro-1H-indazol-7-yl)urea |
| SMILES | COc1cccc(NC(=O)NC2CCCc3cn[nH]c32)c1 |
| InChI | InChI=1S/C15H18N4O2/c1-21-12-6-3-5-11(8-12)17-15(20)18-13-7-2-4-10-9-16-19-14(10)13/h3,5-6,8-9,13H,2,4,7H2,1H3,(H,16,19)(H2,17,18,20) |
| InChIKey | PUZFKDLMGSIVBI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |