About 3-methyl-N-[(1R,2R)-2-methylcyclopropyl]-1H-pyrrole-2-carboxamide
3-methyl-N-[(1R,2R)-2-methylcyclopropyl]-1H-pyrrole-2-carboxamide (PubChem CID 126987776) has the molecular formula C10H14N2O
and a molecular weight of 178.24 g/mol. Its IUPAC name is 3-methyl-N-[(1R,2R)-2-methylcyclopropyl]-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 3-methyl-N-[(1R,2R)-2-methylcyclopropyl]-1H-pyrrole-2-carboxamide |
| PubChem CID | 126987776 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 3-methyl-N-[(1R,2R)-2-methylcyclopropyl]-1H-pyrrole-2-carboxamide |
| SMILES | Cc1cc[nH]c1C(=O)N[C@@H]1C[C@H]1C |
| InChI | InChI=1S/C10H14N2O/c1-6-3-4-11-9(6)10(13)12-8-5-7(8)2/h3-4,7-8,11H,5H2,1-2H3,(H,12,13)/t7-,8-/m1/s1 |
| InChIKey | GATSAJACGNPBKF-HTQZYQBOSA-N |
| XLogP | 1.46 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-N-[(1R,2R)-2-methylcyclopropyl]-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-[(1R,2R)-2-methylcyclopropyl]-1H-pyrrole-2-carboxamide?
The IUPAC name of 3-methyl-N-[(1R,2R)-2-methylcyclopropyl]-1H-pyrrole-2-carboxamide (CID 126987776) is 3-methyl-N-[(1R,2R)-2-methylcyclopropyl]-1H-pyrrole-2-carboxamide.
What is the SMILES notation for 3-methyl-N-[(1R,2R)-2-methylcyclopropyl]-1H-pyrrole-2-carboxamide?
The canonical SMILES for 3-methyl-N-[(1R,2R)-2-methylcyclopropyl]-1H-pyrrole-2-carboxamide is Cc1cc[nH]c1C(=O)N[C@@H]1C[C@H]1C.
What is the InChIKey of 3-methyl-N-[(1R,2R)-2-methylcyclopropyl]-1H-pyrrole-2-carboxamide?
The InChIKey is GATSAJACGNPBKF-HTQZYQBOSA-N. The full InChI is InChI=1S/C10H14N2O/c1-6-3-4-11-9(6)10(13)12-8-5-7(8)2/h3-4,7-8,11H,5H2,1-2H3,(H,12,13)/t7-,8-/m1/s1.
What are the key properties of 3-methyl-N-[(1R,2R)-2-methylcyclopropyl]-1H-pyrrole-2-carboxamide?
3-methyl-N-[(1R,2R)-2-methylcyclopropyl]-1H-pyrrole-2-carboxamide has a molecular weight of 178.24 g/mol, XLogP of 1.46, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-[(1R,2R)-2-methylcyclopropyl]-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 126987776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).