C8H10ClN3O — CID 126987932
2-chloro-N-(5,6-dimethylpyridazin-3-yl)acetamide (PubChem CID 126987932) has the molecular formula C8H10ClN3O and a molecular weight of 199.64 g/mol. Its IUPAC name is 2-chloro-N-(5,6-dimethylpyridazin-3-yl)acetamide.
| Compound Name | 2-chloro-N-(5,6-dimethylpyridazin-3-yl)acetamide |
|---|---|
| PubChem CID | 126987932 |
| Molecular Formula | C8H10ClN3O |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 2-chloro-N-(5,6-dimethylpyridazin-3-yl)acetamide |
| SMILES | Cc1cc(NC(=O)CCl)nnc1C |
| InChI | InChI=1S/C8H10ClN3O/c1-5-3-7(10-8(13)4-9)12-11-6(5)2/h3H,4H2,1-2H3,(H,10,12,13) |
| InChIKey | MILOGQUWHGROBS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|