C8H16O4S — CID 126989817
3-[2-(1,3-dioxolan-2-yl)ethylsulfanyl]propane-1,2-diol (PubChem CID 126989817) has the molecular formula C8H16O4S and a molecular weight of 208.28 g/mol. Its IUPAC name is 3-[2-(1,3-dioxolan-2-yl)ethylsulfanyl]propane-1,2-diol.
| Compound Name | 3-[2-(1,3-dioxolan-2-yl)ethylsulfanyl]propane-1,2-diol |
|---|---|
| PubChem CID | 126989817 |
| Molecular Formula | C8H16O4S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 3-[2-(1,3-dioxolan-2-yl)ethylsulfanyl]propane-1,2-diol |
| SMILES | OCC(O)CSCCC1OCCO1 |
| InChI | InChI=1S/C8H16O4S/c9-5-7(10)6-13-4-1-8-11-2-3-12-8/h7-10H,1-6H2 |
| InChIKey | LSRHHIZJYUIVKV-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|