C7H11Cl3N2O — CID 126990347
3-methyl-1-(3,3,3-trichloropropyl)imidazolidin-4-one (PubChem CID 126990347) has the molecular formula C7H11Cl3N2O and a molecular weight of 245.54 g/mol. Its IUPAC name is 3-methyl-1-(3,3,3-trichloropropyl)imidazolidin-4-one.
| Compound Name | 3-methyl-1-(3,3,3-trichloropropyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 126990347 |
| Molecular Formula | C7H11Cl3N2O |
| Molecular Weight | 245.54 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | 3-methyl-1-(3,3,3-trichloropropyl)imidazolidin-4-one |
| SMILES | CN1CN(CCC(Cl)(Cl)Cl)CC1=O |
| InChI | InChI=1S/C7H11Cl3N2O/c1-11-5-12(4-6(11)13)3-2-7(8,9)10/h2-5H2,1H3 |
| InChIKey | BJRYZOCDAMHIJT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.54 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|