C10H16FNO — CID 126991129
N-[(1-fluorocyclobutyl)methyl]-2-methylcyclopropane-1-carboxamide (PubChem CID 126991129) has the molecular formula C10H16FNO and a molecular weight of 185.24 g/mol. Its IUPAC name is N-[(1-fluorocyclobutyl)methyl]-2-methylcyclopropane-1-carboxamide.
| Compound Name | N-[(1-fluorocyclobutyl)methyl]-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 126991129 |
| Molecular Formula | C10H16FNO |
| Molecular Weight | 185.24 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | N-[(1-fluorocyclobutyl)methyl]-2-methylcyclopropane-1-carboxamide |
| SMILES | CC1CC1C(=O)NCC1(F)CCC1 |
| InChI | InChI=1S/C10H16FNO/c1-7-5-8(7)9(13)12-6-10(11)3-2-4-10/h7-8H,2-6H2,1H3,(H,12,13) |
| InChIKey | PLNCWPGMILAGLB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |