C9H15FN2O — CID 165476129
N-[(3-fluoroazetidin-3-yl)methyl]cyclobutanecarboxamide (PubChem CID 165476129) has the molecular formula C9H15FN2O and a molecular weight of 186.23 g/mol. Its IUPAC name is N-[(3-fluoroazetidin-3-yl)methyl]cyclobutanecarboxamide.
| Compound Name | N-[(3-fluoroazetidin-3-yl)methyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 165476129 |
| Molecular Formula | C9H15FN2O |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | N-[(3-fluoroazetidin-3-yl)methyl]cyclobutanecarboxamide |
| SMILES | O=C(NCC1(F)CNC1)C1CCC1 |
| InChI | InChI=1S/C9H15FN2O/c10-9(4-11-5-9)6-12-8(13)7-2-1-3-7/h7,11H,1-6H2,(H,12,13) |
| InChIKey | OLRBPFQSCIHCMD-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |