C8H10N2O2 — CID 126996478
N-(1,2-oxazol-5-yl)cyclobutanecarboxamide (PubChem CID 126996478) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is N-(1,2-oxazol-5-yl)cyclobutanecarboxamide.
| Compound Name | N-(1,2-oxazol-5-yl)cyclobutanecarboxamide |
|---|---|
| PubChem CID | 126996478 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | N-(1,2-oxazol-5-yl)cyclobutanecarboxamide |
| SMILES | O=C(Nc1ccno1)C1CCC1 |
| InChI | InChI=1S/C8H10N2O2/c11-8(6-2-1-3-6)10-7-4-5-9-12-7/h4-6H,1-3H2,(H,10,11) |
| InChIKey | KZNOKPKHNNSAJN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |