C9H12N2OS2 — CID 126997389
5-methoxy-2-(thiolan-2-yl)-1H-pyrimidine-6-thione (PubChem CID 126997389) has the molecular formula C9H12N2OS2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 5-methoxy-2-(thiolan-2-yl)-1H-pyrimidine-6-thione.
| Compound Name | 5-methoxy-2-(thiolan-2-yl)-1H-pyrimidine-6-thione |
|---|---|
| PubChem CID | 126997389 |
| Molecular Formula | C9H12N2OS2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 5-methoxy-2-(thiolan-2-yl)-1H-pyrimidine-6-thione |
| SMILES | COc1cnc(C2CCCS2)[nH]c1=S |
| InChI | InChI=1S/C9H12N2OS2/c1-12-6-5-10-8(11-9(6)13)7-3-2-4-14-7/h5,7H,2-4H2,1H3,(H,10,11,13) |
| InChIKey | XVUAMFYZJDNMMV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|