C11H12ClNO — CID 91605725
1-chloro-4-methoxy-7,8-dihydro-6H-cyclohepta[c]pyridine (PubChem CID 91605725) has the molecular formula C11H12ClNO and a molecular weight of 209.68 g/mol. Its IUPAC name is 1-chloro-4-methoxy-7,8-dihydro-6H-cyclohepta[c]pyridine.
| Compound Name | 1-chloro-4-methoxy-7,8-dihydro-6H-cyclohepta[c]pyridine |
|---|---|
| PubChem CID | 91605725 |
| Molecular Formula | C11H12ClNO |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 1-chloro-4-methoxy-7,8-dihydro-6H-cyclohepta[c]pyridine |
| SMILES | COc1cnc(Cl)c2c1=CCCCC=2 |
| InChI | InChI=1S/C11H12ClNO/c1-14-10-7-13-11(12)9-6-4-2-3-5-8(9)10/h5-7H,2-4H2,1H3 |
| InChIKey | GDZIHKJXFDPAMV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|