C8H6ClN2O+ — CID 59279410
7-chloro-4-methoxy-1,2-dihydropyrrolo[2,3-c]pyridin-2-ylium (PubChem CID 59279410) has the molecular formula C8H6ClN2O+ and a molecular weight of 181.60 g/mol. Its IUPAC name is 7-chloro-4-methoxy-1,2-dihydropyrrolo[2,3-c]pyridin-2-ylium.
| Compound Name | 7-chloro-4-methoxy-1,2-dihydropyrrolo[2,3-c]pyridin-2-ylium |
|---|---|
| PubChem CID | 59279410 |
| Molecular Formula | C8H6ClN2O+ |
| Molecular Weight | 181.60 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 7-chloro-4-methoxy-1,2-dihydropyrrolo[2,3-c]pyridin-2-ylium |
| SMILES | COc1cnc(Cl)c2c1C=[C+]N2 |
| InChI | InChI=1S/C8H6ClN2O/c1-12-6-4-11-8(9)7-5(6)2-3-10-7/h2,4,10H,1H3/q+1 |
| InChIKey | FXGPQFXXVTWJBW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.60 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|