C8H9BrClN3O — CID 127002096
5-bromo-N-(4-chlorooxolan-3-yl)pyrimidin-4-amine (PubChem CID 127002096) has the molecular formula C8H9BrClN3O and a molecular weight of 278.54 g/mol. Its IUPAC name is 5-bromo-N-(4-chlorooxolan-3-yl)pyrimidin-4-amine.
| Compound Name | 5-bromo-N-(4-chlorooxolan-3-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 127002096 |
| Molecular Formula | C8H9BrClN3O |
| Molecular Weight | 278.54 g/mol |
| Exact Mass | 276.96 |
| IUPAC Name | 5-bromo-N-(4-chlorooxolan-3-yl)pyrimidin-4-amine |
| SMILES | ClC1COCC1Nc1ncncc1Br |
| InChI | InChI=1S/C8H9BrClN3O/c9-5-1-11-4-12-8(5)13-7-3-14-2-6(7)10/h1,4,6-7H,2-3H2,(H,11,12,13) |
| InChIKey | DVEWFOHKDKCKAW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.54 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|