C11H14BrN3 — CID 66340376
N-(2-bicyclo[2.2.1]heptanyl)-5-bromopyrimidin-4-amine (PubChem CID 66340376) has the molecular formula C11H14BrN3 and a molecular weight of 268.16 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanyl)-5-bromopyrimidin-4-amine.
| Compound Name | N-(2-bicyclo[2.2.1]heptanyl)-5-bromopyrimidin-4-amine |
|---|---|
| PubChem CID | 66340376 |
| Molecular Formula | C11H14BrN3 |
| Molecular Weight | 268.16 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanyl)-5-bromopyrimidin-4-amine |
| SMILES | Brc1cncnc1NC1CC2CCC1C2 |
| InChI | InChI=1S/C11H14BrN3/c12-9-5-13-6-14-11(9)15-10-4-7-1-2-8(10)3-7/h5-8,10H,1-4H2,(H,13,14,15) |
| InChIKey | PSYXYBTWZAPCRZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.16 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |