C11H16BrN5 — CID 80917302
N-(2-bicyclo[2.2.1]heptanyl)-5-bromo-2-hydrazinylpyrimidin-4-amine (PubChem CID 80917302) has the molecular formula C11H16BrN5 and a molecular weight of 298.19 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanyl)-5-bromo-2-hydrazinylpyrimidin-4-amine.
| Compound Name | N-(2-bicyclo[2.2.1]heptanyl)-5-bromo-2-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80917302 |
| Molecular Formula | C11H16BrN5 |
| Molecular Weight | 298.19 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanyl)-5-bromo-2-hydrazinylpyrimidin-4-amine |
| SMILES | NNc1ncc(Br)c(NC2CC3CCC2C3)n1 |
| InChI | InChI=1S/C11H16BrN5/c12-8-5-14-11(17-13)16-10(8)15-9-4-6-1-2-7(9)3-6/h5-7,9H,1-4,13H2,(H2,14,15,16,17) |
| InChIKey | CGZMMWRFRBBWQK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.19 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|