C9H14BrN5O — CID 82737407
5-bromo-2-hydrazinyl-N-(2-methyloxolan-3-yl)pyrimidin-4-amine (PubChem CID 82737407) has the molecular formula C9H14BrN5O and a molecular weight of 288.15 g/mol. Its IUPAC name is 5-bromo-2-hydrazinyl-N-(2-methyloxolan-3-yl)pyrimidin-4-amine.
| Compound Name | 5-bromo-2-hydrazinyl-N-(2-methyloxolan-3-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 82737407 |
| Molecular Formula | C9H14BrN5O |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 5-bromo-2-hydrazinyl-N-(2-methyloxolan-3-yl)pyrimidin-4-amine |
| SMILES | CC1OCCC1Nc1nc(NN)ncc1Br |
| InChI | InChI=1S/C9H14BrN5O/c1-5-7(2-3-16-5)13-8-6(10)4-12-9(14-8)15-11/h4-5,7H,2-3,11H2,1H3,(H2,12,13,14,15) |
| InChIKey | SUDOUJRJUNIOLJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|