C14H23N7 — CID 80910324
N-(2-bicyclo[2.2.1]heptanyl)-4-hydrazinyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 80910324) has the molecular formula C14H23N7 and a molecular weight of 289.39 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanyl)-4-hydrazinyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-(2-bicyclo[2.2.1]heptanyl)-4-hydrazinyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80910324 |
| Molecular Formula | C14H23N7 |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanyl)-4-hydrazinyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | NNc1nc(NC2CC3CCC2C3)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C14H23N7/c15-20-13-17-12(16-11-8-9-3-4-10(11)7-9)18-14(19-13)21-5-1-2-6-21/h9-11H,1-8,15H2,(H2,16,17,18,19,20) |
| InChIKey | IGRBUKDQFNXKPA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|