C9H12N2OS — CID 127002356
azetidin-1-yl-(4-ethyl-1,3-thiazol-5-yl)methanone (PubChem CID 127002356) has the molecular formula C9H12N2OS and a molecular weight of 196.27 g/mol. Its IUPAC name is azetidin-1-yl-(4-ethyl-1,3-thiazol-5-yl)methanone.
| Compound Name | azetidin-1-yl-(4-ethyl-1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 127002356 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | azetidin-1-yl-(4-ethyl-1,3-thiazol-5-yl)methanone |
| SMILES | CCc1ncsc1C(=O)N1CCC1 |
| InChI | InChI=1S/C9H12N2OS/c1-2-7-8(13-6-10-7)9(12)11-4-3-5-11/h6H,2-5H2,1H3 |
| InChIKey | SQBSAJORWMVQPR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |