C11H16ClNS — CID 127002529
4-(1-chloro-2-methylpropan-2-yl)sulfanyl-2,6-dimethylpyridine (PubChem CID 127002529) has the molecular formula C11H16ClNS and a molecular weight of 229.78 g/mol. Its IUPAC name is 4-(1-chloro-2-methylpropan-2-yl)sulfanyl-2,6-dimethylpyridine.
| Compound Name | 4-(1-chloro-2-methylpropan-2-yl)sulfanyl-2,6-dimethylpyridine |
|---|---|
| PubChem CID | 127002529 |
| Molecular Formula | C11H16ClNS |
| Molecular Weight | 229.78 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 4-(1-chloro-2-methylpropan-2-yl)sulfanyl-2,6-dimethylpyridine |
| SMILES | Cc1cc(SC(C)(C)CCl)cc(C)n1 |
| InChI | InChI=1S/C11H16ClNS/c1-8-5-10(6-9(2)13-8)14-11(3,4)7-12/h5-6H,7H2,1-4H3 |
| InChIKey | DINGDTSWMXCZIG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.78 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|