C6H9F2N3S — CID 127011547
methyl N-cyano-N'-(1,1-difluoropropan-2-yl)carbamimidothioate (PubChem CID 127011547) has the molecular formula C6H9F2N3S and a molecular weight of 193.22 g/mol. Its IUPAC name is methyl N-cyano-N'-(1,1-difluoropropan-2-yl)carbamimidothioate.
| Compound Name | methyl N-cyano-N'-(1,1-difluoropropan-2-yl)carbamimidothioate |
|---|---|
| PubChem CID | 127011547 |
| Molecular Formula | C6H9F2N3S |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | methyl N-cyano-N'-(1,1-difluoropropan-2-yl)carbamimidothioate |
| SMILES | CS/C(=N\C(C)C(F)F)NC#N |
| InChI | InChI=1S/C6H9F2N3S/c1-4(5(7)8)11-6(12-2)10-3-9/h4-5H,1-2H3,(H,10,11) |
| InChIKey | ZTGRYFJTSNWIMO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|