C6H7F4N3S — CID 106292733
methyl N-cyano-N'-(2,2,3,3-tetrafluoropropyl)carbamimidothioate (PubChem CID 106292733) has the molecular formula C6H7F4N3S and a molecular weight of 229.20 g/mol. Its IUPAC name is methyl N-cyano-N'-(2,2,3,3-tetrafluoropropyl)carbamimidothioate.
| Compound Name | methyl N-cyano-N'-(2,2,3,3-tetrafluoropropyl)carbamimidothioate |
|---|---|
| PubChem CID | 106292733 |
| Molecular Formula | C6H7F4N3S |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | methyl N-cyano-N'-(2,2,3,3-tetrafluoropropyl)carbamimidothioate |
| SMILES | CS/C(=N\CC(F)(F)C(F)F)NC#N |
| InChI | InChI=1S/C6H7F4N3S/c1-14-5(13-3-11)12-2-6(9,10)4(7)8/h4H,2H2,1H3,(H,12,13) |
| InChIKey | QWOIBQOHWABTJP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|