C8H10F5N3S — CID 22033240
methyl N-cyano-N'-(4,4,5,5,5-pentafluoropentyl)carbamimidothioate (PubChem CID 22033240) has the molecular formula C8H10F5N3S and a molecular weight of 275.25 g/mol. Its IUPAC name is methyl N-cyano-N'-(4,4,5,5,5-pentafluoropentyl)carbamimidothioate.
| Compound Name | methyl N-cyano-N'-(4,4,5,5,5-pentafluoropentyl)carbamimidothioate |
|---|---|
| PubChem CID | 22033240 |
| Molecular Formula | C8H10F5N3S |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | methyl N-cyano-N'-(4,4,5,5,5-pentafluoropentyl)carbamimidothioate |
| SMILES | CS/C(=N\CCCC(F)(F)C(F)(F)F)NC#N |
| InChI | InChI=1S/C8H10F5N3S/c1-17-6(16-5-14)15-4-2-3-7(9,10)8(11,12)13/h2-4H2,1H3,(H,15,16) |
| InChIKey | RAPLPGVGQWVFQP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|