C8H12F3N3S — CID 115519740
methyl N-cyano-N'-(5,5,5-trifluoropentyl)carbamimidothioate (PubChem CID 115519740) has the molecular formula C8H12F3N3S and a molecular weight of 239.27 g/mol. Its IUPAC name is methyl N-cyano-N'-(5,5,5-trifluoropentyl)carbamimidothioate.
| Compound Name | methyl N-cyano-N'-(5,5,5-trifluoropentyl)carbamimidothioate |
|---|---|
| PubChem CID | 115519740 |
| Molecular Formula | C8H12F3N3S |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | methyl N-cyano-N'-(5,5,5-trifluoropentyl)carbamimidothioate |
| SMILES | CS/C(=N\CCCCC(F)(F)F)NC#N |
| InChI | InChI=1S/C8H12F3N3S/c1-15-7(14-6-12)13-5-3-2-4-8(9,10)11/h2-5H2,1H3,(H,13,14) |
| InChIKey | UTXUADOAIJNXML-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|