C12H18O7 — CID 1270122
(1R,3aS,5R,6S,7R,7aS)-5,6,7-trimethoxy-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-2-benzofuran-1-carboxylic acid (PubChem CID 1270122) has the molecular formula C12H18O7 and a molecular weight of 274.27 g/mol. Its IUPAC name is (1R,3aS,5R,6S,7R,7aS)-5,6,7-trimethoxy-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-2-benzofuran-1-carboxylic acid.
| Compound Name | (1R,3aS,5R,6S,7R,7aS)-5,6,7-trimethoxy-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-2-benzofuran-1-carboxylic acid |
|---|---|
| PubChem CID | 1270122 |
| Molecular Formula | C12H18O7 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | (1R,3aS,5R,6S,7R,7aS)-5,6,7-trimethoxy-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-2-benzofuran-1-carboxylic acid |
| SMILES | CO[C@@H]1[C@H](OC)[C@@H]2[C@H](C[C@H]1OC)C(=O)O[C@H]2C(=O)O |
| InChI | InChI=1S/C12H18O7/c1-16-6-4-5-7(9(18-3)8(6)17-2)10(11(13)14)19-12(5)15/h5-10H,4H2,1-3H3,(H,13,14)/t5-,6+,7-,8-,9+,10+/m0/s1 |
| InChIKey | LEIAHOOEPZPKFU-KIOSUUARSA-N |
| XLogP | -0.32 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |