C10H17NO2S — CID 127015011
N-(4,4-dimethylpent-2-ynyl)-1,1-dioxothietan-3-amine (PubChem CID 127015011) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is N-(4,4-dimethylpent-2-ynyl)-1,1-dioxothietan-3-amine.
| Compound Name | N-(4,4-dimethylpent-2-ynyl)-1,1-dioxothietan-3-amine |
|---|---|
| PubChem CID | 127015011 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | N-(4,4-dimethylpent-2-ynyl)-1,1-dioxothietan-3-amine |
| SMILES | CC(C)(C)C#CCNC1CS(=O)(=O)C1 |
| InChI | InChI=1S/C10H17NO2S/c1-10(2,3)5-4-6-11-9-7-14(12,13)8-9/h9,11H,6-8H2,1-3H3 |
| InChIKey | CHROKADJLRBEQS-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|