C19H28F6N4O5 — CID 127023587
(3aR,7aS)-5-(2-methoxyethyl)-2-[(1-methylimidazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127023587) has the molecular formula C19H28F6N4O5 and a molecular weight of 506.44 g/mol. Its IUPAC name is (3aR,7aS)-5-(2-methoxyethyl)-2-[(1-methylimidazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aR,7aS)-5-(2-methoxyethyl)-2-[(1-methylimidazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127023587 |
| Molecular Formula | C19H28F6N4O5 |
| Molecular Weight | 506.44 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | (3aR,7aS)-5-(2-methoxyethyl)-2-[(1-methylimidazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COCCN1CC[C@@H]2CN(Cc3nccn3C)C[C@@H]2C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H26N4O.2C2HF3O2/c1-17-6-4-16-15(17)12-19-9-13-3-5-18(7-8-20-2)10-14(13)11-19;2*3-2(4,5)1(6)7/h4,6,13-14H,3,5,7-12H2,1-2H3;2*(H,6,7)/t13-,14+;;/m1../s1 |
| InChIKey | DVLNGBXEACUZFE-BQFBZIMZSA-N |
| XLogP | 2.09 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |