C19H28F6N4O6 — CID 155849667
(7R,8aS)-7-(2-methoxyethoxy)-2-[(1-methylimidazol-2-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155849667) has the molecular formula C19H28F6N4O6 and a molecular weight of 522.44 g/mol. Its IUPAC name is (7R,8aS)-7-(2-methoxyethoxy)-2-[(1-methylimidazol-2-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (7R,8aS)-7-(2-methoxyethoxy)-2-[(1-methylimidazol-2-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155849667 |
| Molecular Formula | C19H28F6N4O6 |
| Molecular Weight | 522.44 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | (7R,8aS)-7-(2-methoxyethoxy)-2-[(1-methylimidazol-2-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COCCO[C@@H]1C[C@H]2CN(Cc3nccn3C)CCN2C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H26N4O2.2C2HF3O2/c1-17-4-3-16-15(17)12-18-5-6-19-11-14(9-13(19)10-18)21-8-7-20-2;2*3-2(4,5)1(6)7/h3-4,13-14H,5-12H2,1-2H3;2*(H,6,7)/t13-,14+;;/m0../s1 |
| InChIKey | RVNAUFHFAPVGSQ-WICJZZOFSA-N |
| XLogP | 1.61 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|