C18H25F3N4O5 — CID 127024036
N-[(4aS,8R,8aS)-6-(2-methoxyethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 127024036) has the molecular formula C18H25F3N4O5 and a molecular weight of 434.42 g/mol. Its IUPAC name is N-[(4aS,8R,8aS)-6-(2-methoxyethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(4aS,8R,8aS)-6-(2-methoxyethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127024036 |
| Molecular Formula | C18H25F3N4O5 |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-[(4aS,8R,8aS)-6-(2-methoxyethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCN1C[C@@H]2CCCO[C@@H]2[C@H](NC(=O)c2cnccn2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N4O3.C2HF3O2/c1-22-8-6-20-10-12-3-2-7-23-15(12)14(11-20)19-16(21)13-9-17-4-5-18-13;3-2(4,5)1(6)7/h4-5,9,12,14-15H,2-3,6-8,10-11H2,1H3,(H,19,21);(H,6,7)/t12-,14+,15-;/m0./s1 |
| InChIKey | ACHOJHUYBNXGSR-DWGNNRDYSA-N |
| XLogP | 0.97 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |