C13H12Br2N2O3S — CID 127027097
4-[(3,5-dibromo-2-hydroxyphenyl)methylamino]benzenesulfonamide (PubChem CID 127027097) has the molecular formula C13H12Br2N2O3S and a molecular weight of 436.13 g/mol. Its IUPAC name is 4-[(3,5-dibromo-2-hydroxyphenyl)methylamino]benzenesulfonamide.
| Compound Name | 4-[(3,5-dibromo-2-hydroxyphenyl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 127027097 |
| Molecular Formula | C13H12Br2N2O3S |
| Molecular Weight | 436.13 g/mol |
| Exact Mass | 433.89 |
| IUPAC Name | 4-[(3,5-dibromo-2-hydroxyphenyl)methylamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NCc2cc(Br)cc(Br)c2O)cc1 |
| InChI | InChI=1S/C13H12Br2N2O3S/c14-9-5-8(13(18)12(15)6-9)7-17-10-1-3-11(4-2-10)21(16,19)20/h1-6,17-18H,7H2,(H2,16,19,20) |
| InChIKey | QKZSRLOSFYYOGI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.13 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|